C10H9F — CID 45090452
1-buta-1,3-dien-2-yl-4-fluorobenzene (PubChem CID 45090452) has the molecular formula C10H9F and a molecular weight of 148.18 g/mol. Its IUPAC name is 1-buta-1,3-dien-2-yl-4-fluorobenzene.
| Compound Name | 1-buta-1,3-dien-2-yl-4-fluorobenzene |
|---|---|
| PubChem CID | 45090452 |
| Molecular Formula | C10H9F |
| Molecular Weight | 148.18 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | 1-buta-1,3-dien-2-yl-4-fluorobenzene |
| SMILES | C=CC(=C)c1ccc(F)cc1 |
| InChI | InChI=1S/C10H9F/c1-3-8(2)9-4-6-10(11)7-5-9/h3-7H,1-2H2 |
| InChIKey | OFSQPNNECWGYHQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.18 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|