C12H13F — CID 86259242
1-fluoro-4-(3-methylpenta-1,4-dien-2-yl)benzene (PubChem CID 86259242) has the molecular formula C12H13F and a molecular weight of 176.23 g/mol. Its IUPAC name is 1-fluoro-4-(3-methylpenta-1,4-dien-2-yl)benzene.
| Compound Name | 1-fluoro-4-(3-methylpenta-1,4-dien-2-yl)benzene |
|---|---|
| PubChem CID | 86259242 |
| Molecular Formula | C12H13F |
| Molecular Weight | 176.23 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | 1-fluoro-4-(3-methylpenta-1,4-dien-2-yl)benzene |
| SMILES | C=CC(C)C(=C)c1ccc(F)cc1 |
| InChI | InChI=1S/C12H13F/c1-4-9(2)10(3)11-5-7-12(13)8-6-11/h4-9H,1,3H2,2H3 |
| InChIKey | BGDQWXDIVBTGTR-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.23 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|