C10H12FN — CID 54285953
1-(4-fluorophenyl)-N,N-dimethylethenamine (PubChem CID 54285953) has the molecular formula C10H12FN and a molecular weight of 165.21 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N,N-dimethylethenamine.
| Compound Name | 1-(4-fluorophenyl)-N,N-dimethylethenamine |
|---|---|
| PubChem CID | 54285953 |
| Molecular Formula | C10H12FN |
| Molecular Weight | 165.21 g/mol |
| Exact Mass | 165.10 |
| IUPAC Name | 1-(4-fluorophenyl)-N,N-dimethylethenamine |
| SMILES | C=C(c1ccc(F)cc1)N(C)C |
| InChI | InChI=1S/C10H12FN/c1-8(12(2)3)9-4-6-10(11)7-5-9/h4-7H,1H2,2-3H3 |
| InChIKey | RUCYPQDWYGKPLK-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.21 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |