C11H14FN — CID 174492825
2-(4-fluorophenyl)-N,N-dimethylprop-1-en-1-amine (PubChem CID 174492825) has the molecular formula C11H14FN and a molecular weight of 179.24 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N,N-dimethylprop-1-en-1-amine.
| Compound Name | 2-(4-fluorophenyl)-N,N-dimethylprop-1-en-1-amine |
|---|---|
| PubChem CID | 174492825 |
| Molecular Formula | C11H14FN |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | 2-(4-fluorophenyl)-N,N-dimethylprop-1-en-1-amine |
| SMILES | CC(=CN(C)C)c1ccc(F)cc1 |
| InChI | InChI=1S/C11H14FN/c1-9(8-13(2)3)10-4-6-11(12)7-5-10/h4-8H,1-3H3 |
| InChIKey | OFPXKLMTZGJRCX-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |