About 1-(2-fluoro-4,5-dimethylphenyl)prop-2-en-1-one
1-(2-fluoro-4,5-dimethylphenyl)prop-2-en-1-one (PubChem CID 83957904) has the molecular formula C11H11FO
and a molecular weight of 178.21 g/mol. Its IUPAC name is 1-(2-fluoro-4,5-dimethylphenyl)prop-2-en-1-one.
Molecular Properties
| Compound Name | 1-(2-fluoro-4,5-dimethylphenyl)prop-2-en-1-one |
| PubChem CID | 83957904 |
| Molecular Formula | C11H11FO |
| Molecular Weight | 178.21 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | 1-(2-fluoro-4,5-dimethylphenyl)prop-2-en-1-one |
| SMILES | C=CC(=O)c1cc(C)c(C)cc1F |
| InChI | InChI=1S/C11H11FO/c1-4-11(13)9-5-7(2)8(3)6-10(9)12/h4-6H,1H2,2-3H3 |
| InChIKey | LRKLHUVMIACRKV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.21 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-fluoro-4,5-dimethylphenyl)prop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-fluoro-4,5-dimethylphenyl)prop-2-en-1-one?
The IUPAC name of 1-(2-fluoro-4,5-dimethylphenyl)prop-2-en-1-one (CID 83957904) is 1-(2-fluoro-4,5-dimethylphenyl)prop-2-en-1-one.
What is the SMILES notation for 1-(2-fluoro-4,5-dimethylphenyl)prop-2-en-1-one?
The canonical SMILES for 1-(2-fluoro-4,5-dimethylphenyl)prop-2-en-1-one is C=CC(=O)c1cc(C)c(C)cc1F.
What is the InChIKey of 1-(2-fluoro-4,5-dimethylphenyl)prop-2-en-1-one?
The InChIKey is LRKLHUVMIACRKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11FO/c1-4-11(13)9-5-7(2)8(3)6-10(9)12/h4-6H,1H2,2-3H3.
What are the key properties of 1-(2-fluoro-4,5-dimethylphenyl)prop-2-en-1-one?
1-(2-fluoro-4,5-dimethylphenyl)prop-2-en-1-one has a molecular weight of 178.21 g/mol, XLogP of 2.81, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-fluoro-4,5-dimethylphenyl)prop-2-en-1-one is sourced from PubChem (CID 83957904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).