C11H11FO — CID 83957904
1-(2-fluoro-4,5-dimethylphenyl)prop-2-en-1-one (PubChem CID 83957904) has the molecular formula C11H11FO and a molecular weight of 178.21 g/mol. Its IUPAC name is 1-(2-fluoro-4,5-dimethylphenyl)prop-2-en-1-one.
| Compound Name | 1-(2-fluoro-4,5-dimethylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 83957904 |
| Molecular Formula | C11H11FO |
| Molecular Weight | 178.21 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | 1-(2-fluoro-4,5-dimethylphenyl)prop-2-en-1-one |
| SMILES | C=CC(=O)c1cc(C)c(C)cc1F |
| InChI | InChI=1S/C11H11FO/c1-4-11(13)9-5-7(2)8(3)6-10(9)12/h4-6H,1H2,2-3H3 |
| InChIKey | LRKLHUVMIACRKV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.21 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|