C13H5F6NO — CID 134617305
2-fluoro-3-(2,3,4,5,6-pentafluorophenyl)benzamide (PubChem CID 134617305) has the molecular formula C13H5F6NO and a molecular weight of 305.18 g/mol. Its IUPAC name is 2-fluoro-3-(2,3,4,5,6-pentafluorophenyl)benzamide.
| Compound Name | 2-fluoro-3-(2,3,4,5,6-pentafluorophenyl)benzamide |
|---|---|
| PubChem CID | 134617305 |
| Molecular Formula | C13H5F6NO |
| Molecular Weight | 305.18 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | 2-fluoro-3-(2,3,4,5,6-pentafluorophenyl)benzamide |
| SMILES | NC(=O)c1cccc(-c2c(F)c(F)c(F)c(F)c2F)c1F |
| InChI | InChI=1S/C13H5F6NO/c14-7-4(2-1-3-5(7)13(20)21)6-8(15)10(17)12(19)11(18)9(6)16/h1-3H,(H2,20,21) |
| InChIKey | ZDPCCIORLSUSRS-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.18 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|