C13H15N — CID 144768170
2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]aniline (PubChem CID 144768170) has the molecular formula C13H15N and a molecular weight of 185.27 g/mol. Its IUPAC name is 2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]aniline.
| Compound Name | 2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]aniline |
|---|---|
| PubChem CID | 144768170 |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]aniline |
| SMILES | C=C/C(=C\C=C/C)c1ccccc1N |
| InChI | InChI=1S/C13H15N/c1-3-5-8-11(4-2)12-9-6-7-10-13(12)14/h3-10H,2,14H2,1H3/b5-3-,11-8+ |
| InChIKey | YWJRKUCPRVXIQJ-NJHUYJSNSA-N |
| XLogP | 3.41 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|