C17H16N2O2 — CID 89133267
[4-amino-5-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-1,2-oxazol-3-yl]-phenylmethanone (PubChem CID 89133267) has the molecular formula C17H16N2O2 and a molecular weight of 280.33 g/mol. Its IUPAC name is [4-amino-5-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-1,2-oxazol-3-yl]-phenylmethanone.
| Compound Name | [4-amino-5-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-1,2-oxazol-3-yl]-phenylmethanone |
|---|---|
| PubChem CID | 89133267 |
| Molecular Formula | C17H16N2O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | [4-amino-5-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-1,2-oxazol-3-yl]-phenylmethanone |
| SMILES | C=C/C(=C\C=C/C)c1onc(C(=O)c2ccccc2)c1N |
| InChI | InChI=1S/C17H16N2O2/c1-3-5-9-12(4-2)17-14(18)15(19-21-17)16(20)13-10-7-6-8-11-13/h3-11H,2,18H2,1H3/b5-3-,12-9+ |
| InChIKey | AGIWPGGBFVJTEU-FNNBZGKSSA-N |
| XLogP | 3.63 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|