C21H22O2 — CID 144804055
4-[[3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-2-methylphenyl]methoxy]phenol (PubChem CID 144804055) has the molecular formula C21H22O2 and a molecular weight of 306.41 g/mol. Its IUPAC name is 4-[[3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-2-methylphenyl]methoxy]phenol.
| Compound Name | 4-[[3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-2-methylphenyl]methoxy]phenol |
|---|---|
| PubChem CID | 144804055 |
| Molecular Formula | C21H22O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 4-[[3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-2-methylphenyl]methoxy]phenol |
| SMILES | C=C/C(=C\C=C/C)c1cccc(COc2ccc(O)cc2)c1C |
| InChI | InChI=1S/C21H22O2/c1-4-6-8-17(5-2)21-10-7-9-18(16(21)3)15-23-20-13-11-19(22)12-14-20/h4-14,22H,2,15H2,1,3H3/b6-4-,17-8+ |
| InChIKey | ZUCBAHZVRVLZIT-VHRUWASDSA-N |
| XLogP | 5.43 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|