C21H33N3 — CID 145428630
ethane;(3E,5Z)-hepta-1,3,5-trien-3-amine;naphthalene-1,4-diamine (PubChem CID 145428630) has the molecular formula C21H33N3 and a molecular weight of 327.52 g/mol. Its IUPAC name is ethane;(3E,5Z)-hepta-1,3,5-trien-3-amine;naphthalene-1,4-diamine.
| Compound Name | ethane;(3E,5Z)-hepta-1,3,5-trien-3-amine;naphthalene-1,4-diamine |
|---|---|
| PubChem CID | 145428630 |
| Molecular Formula | C21H33N3 |
| Molecular Weight | 327.52 g/mol |
| Exact Mass | 327.27 |
| IUPAC Name | ethane;(3E,5Z)-hepta-1,3,5-trien-3-amine;naphthalene-1,4-diamine |
| SMILES | C=C/C(N)=C\C=C/C.CC.CC.Nc1ccc(N)c2ccccc12 |
| InChI | InChI=1S/C10H10N2.C7H11N.2C2H6/c11-9-5-6-10(12)8-4-2-1-3-7(8)9;1-3-5-6-7(8)4-2;2*1-2/h1-6H,11-12H2;3-6H,2,8H2,1H3;2*1-2H3/b;5-3-,7-6+;; |
| InChIKey | MPRVSJJLQNHMJQ-VHIYAMGISA-N |
| XLogP | 5.65 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.52 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|