C24H30 — CID 142508908
4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-9,9-dimethylfluorene;methane (PubChem CID 142508908) has the molecular formula C24H30 and a molecular weight of 318.50 g/mol. Its IUPAC name is 4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-9,9-dimethylfluorene;methane.
| Compound Name | 4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-9,9-dimethylfluorene;methane |
|---|---|
| PubChem CID | 142508908 |
| Molecular Formula | C24H30 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | 4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-9,9-dimethylfluorene;methane |
| SMILES | C.C.C=C/C(=C\C=C/C)c1cccc2c1-c1ccccc1C2(C)C |
| InChI | InChI=1S/C22H22.2CH4/c1-5-7-11-16(6-2)17-13-10-15-20-21(17)18-12-8-9-14-19(18)22(20,3)4;;/h5-15H,2H2,1,3-4H3;2*1H4/b7-5-,16-11+;; |
| InChIKey | YFVDXCMGGHTONW-OSDVCTNISA-N |
| XLogP | 7.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|