C26H26 — CID 142585263
9-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-9-[(3E)-hexa-1,3-dien-3-yl]fluorene (PubChem CID 142585263) has the molecular formula C26H26 and a molecular weight of 338.49 g/mol. Its IUPAC name is 9-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-9-[(3E)-hexa-1,3-dien-3-yl]fluorene.
| Compound Name | 9-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-9-[(3E)-hexa-1,3-dien-3-yl]fluorene |
|---|---|
| PubChem CID | 142585263 |
| Molecular Formula | C26H26 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 9-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-9-[(3E)-hexa-1,3-dien-3-yl]fluorene |
| SMILES | C=C/C(=C\C=C/C)C1(/C(C=C)=C/CC)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C26H26/c1-5-9-15-21(8-4)26(20(7-3)14-6-2)24-18-12-10-16-22(24)23-17-11-13-19-25(23)26/h5,7-19H,3-4,6H2,1-2H3/b9-5-,20-14+,21-15+ |
| InChIKey | XPOXGMLNTJTRIM-KJTZEEGVSA-N |
| XLogP | 7.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|