C26H26 — CID 144566390
9-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-9-[(2E,4Z)-hexa-2,4-dien-2-yl]fluorene (PubChem CID 144566390) has the molecular formula C26H26 and a molecular weight of 338.49 g/mol. Its IUPAC name is 9-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-9-[(2E,4Z)-hexa-2,4-dien-2-yl]fluorene.
| Compound Name | 9-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-9-[(2E,4Z)-hexa-2,4-dien-2-yl]fluorene |
|---|---|
| PubChem CID | 144566390 |
| Molecular Formula | C26H26 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 9-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-9-[(2E,4Z)-hexa-2,4-dien-2-yl]fluorene |
| SMILES | C=C/C=C(\C=C/C)C1(/C(C)=C/C=C\C)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C26H26/c1-5-8-15-20(4)26(21(13-6-2)14-7-3)24-18-11-9-16-22(24)23-17-10-12-19-25(23)26/h5-19H,2H2,1,3-4H3/b8-5-,14-7-,20-15+,21-13+ |
| InChIKey | BOKRCQBJCVRJLY-WRTOFRCFSA-N |
| XLogP | 7.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|