C27H25NO — CID 139447254
3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3-[(3E)-hexa-1,3,5-trien-3-yl]-2-phenylisoindol-1-one (PubChem CID 139447254) has the molecular formula C27H25NO and a molecular weight of 379.50 g/mol. Its IUPAC name is 3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3-[(3E)-hexa-1,3,5-trien-3-yl]-2-phenylisoindol-1-one.
| Compound Name | 3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3-[(3E)-hexa-1,3,5-trien-3-yl]-2-phenylisoindol-1-one |
|---|---|
| PubChem CID | 139447254 |
| Molecular Formula | C27H25NO |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-3-[(3E)-hexa-1,3,5-trien-3-yl]-2-phenylisoindol-1-one |
| SMILES | C=C/C=C(\C=C)C1(C(/C=C\C)=C/C=C)c2ccccc2C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C27H25NO/c1-5-14-21(8-4)27(22(15-6-2)16-7-3)25-20-13-12-19-24(25)26(29)28(27)23-17-10-9-11-18-23/h5-20H,1-2,4H2,3H3/b16-7-,21-14+,22-15+ |
| InChIKey | ZTAFZLMNAVFWGX-AUMFFFKGSA-N |
| XLogP | 6.53 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|