C28H26 — CID 145055361
9-[(3E)-hexa-1,3,5-trien-3-yl]-9-[(3Z,5E,7Z)-nona-1,3,5,7-tetraen-5-yl]fluorene (PubChem CID 145055361) has the molecular formula C28H26 and a molecular weight of 362.52 g/mol. Its IUPAC name is 9-[(3E)-hexa-1,3,5-trien-3-yl]-9-[(3Z,5E,7Z)-nona-1,3,5,7-tetraen-5-yl]fluorene.
| Compound Name | 9-[(3E)-hexa-1,3,5-trien-3-yl]-9-[(3Z,5E,7Z)-nona-1,3,5,7-tetraen-5-yl]fluorene |
|---|---|
| PubChem CID | 145055361 |
| Molecular Formula | C28H26 |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 9-[(3E)-hexa-1,3,5-trien-3-yl]-9-[(3Z,5E,7Z)-nona-1,3,5,7-tetraen-5-yl]fluorene |
| SMILES | C=C/C=C\C(=C/C=C\C)C1(/C(C=C)=C/C=C)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C28H26/c1-5-9-16-23(17-10-6-2)28(22(8-4)15-7-3)26-20-13-11-18-24(26)25-19-12-14-21-27(25)28/h5-21H,1,3-4H2,2H3/b10-6-,16-9-,22-15+,23-17+ |
| InChIKey | GBOJHNCDVLKGKT-BJRHDDRVSA-N |
| XLogP | 7.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|