C28H26 — CID 175618612
(2E,3Z)-3-ethylidene-1-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-1-phenyl-2-prop-2-enylideneindene (PubChem CID 175618612) has the molecular formula C28H26 and a molecular weight of 362.52 g/mol. Its IUPAC name is (2E,3Z)-3-ethylidene-1-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-1-phenyl-2-prop-2-enylideneindene.
| Compound Name | (2E,3Z)-3-ethylidene-1-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-1-phenyl-2-prop-2-enylideneindene |
|---|---|
| PubChem CID | 175618612 |
| Molecular Formula | C28H26 |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | (2E,3Z)-3-ethylidene-1-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-1-phenyl-2-prop-2-enylideneindene |
| SMILES | C=C/C=C\C(=C/C=C)C1(c2ccccc2)C(=C/C=C)/C(=C\C)c2ccccc21 |
| InChI | InChI=1S/C28H26/c1-5-9-17-22(15-6-2)28(23-18-11-10-12-19-23)26(16-7-3)24(8-4)25-20-13-14-21-27(25)28/h5-21H,1-3H2,4H3/b17-9-,22-15+,24-8-,26-16+ |
| InChIKey | SJBHHLPTTAORPE-BIOGFMMDSA-N |
| XLogP | 7.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|