C40H34 — CID 142385277
3-[3-(4-ethylphenyl)phenyl]-9-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-9-phenylfluorene (PubChem CID 142385277) has the molecular formula C40H34 and a molecular weight of 514.71 g/mol. Its IUPAC name is 3-[3-(4-ethylphenyl)phenyl]-9-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-9-phenylfluorene.
| Compound Name | 3-[3-(4-ethylphenyl)phenyl]-9-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-9-phenylfluorene |
|---|---|
| PubChem CID | 142385277 |
| Molecular Formula | C40H34 |
| Molecular Weight | 514.71 g/mol |
| Exact Mass | 514.27 |
| IUPAC Name | 3-[3-(4-ethylphenyl)phenyl]-9-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-9-phenylfluorene |
| SMILES | C=C/C=C\C(=C/C)C1(c2ccccc2)c2ccccc2-c2cc(-c3cccc(-c4ccc(CC)cc4)c3)ccc21 |
| InChI | InChI=1S/C40H34/c1-4-7-16-34(6-3)40(35-17-9-8-10-18-35)38-20-12-11-19-36(38)37-28-33(25-26-39(37)40)32-15-13-14-31(27-32)30-23-21-29(5-2)22-24-30/h4,6-28H,1,5H2,2-3H3/b16-7-,34-6+ |
| InChIKey | PZIWJBIWRXJZDB-GKFPTQDVSA-N |
| XLogP | 10.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.71 |
| LogP ≤ 5 | 10.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|