C50H48N2 — CID 142385258
N-[(3E,5Z,8E,9Z)-4-ethenyl-8-ethylidene-7-methylidenedodeca-3,5,9,11-tetraen-5-yl]methanimine;2-[3-(4-ethylphenyl)-9-phenylfluoren-9-yl]pyridine (PubChem CID 142385258) has the molecular formula C50H48N2 and a molecular weight of 676.95 g/mol. Its IUPAC name is N-[(3E,5Z,8E,9Z)-4-ethenyl-8-ethylidene-7-methylidenedodeca-3,5,9,11-tetraen-5-yl]methanimine;2-[3-(4-ethylphenyl)-9-phenylfluoren-9-yl]pyridine.
| Compound Name | N-[(3E,5Z,8E,9Z)-4-ethenyl-8-ethylidene-7-methylidenedodeca-3,5,9,11-tetraen-5-yl]methanimine;2-[3-(4-ethylphenyl)-9-phenylfluoren-9-yl]pyridine |
|---|---|
| PubChem CID | 142385258 |
| Molecular Formula | C50H48N2 |
| Molecular Weight | 676.95 g/mol |
| Exact Mass | 676.38 |
| IUPAC Name | N-[(3E,5Z,8E,9Z)-4-ethenyl-8-ethylidene-7-methylidenedodeca-3,5,9,11-tetraen-5-yl]methanimine;2-[3-(4-ethylphenyl)-9-phenylfluoren-9-yl]pyridine |
| SMILES | C=C/C=C\C(=C/C)C(=C)/C=C(N=C)/C(C=C)=C/CC.CCc1ccc(-c2ccc3c(c2)-c2ccccc2C3(c2ccccc2)c2ccccn2)cc1 |
| InChI | InChI=1S/C32H25N.C18H23N/c1-2-23-15-17-24(18-16-23)25-19-20-30-28(22-25)27-12-6-7-13-29(27)32(30,26-10-4-3-5-11-26)31-14-8-9-21-33-31;1-7-11-13-16(9-3)15(5)14-18(19-6)17(10-4)12-8-2/h3-22H,2H2,1H3;7,9-14H,1,4-6,8H2,2-3H3/b;13-11-,16-9+,17-12+,18-14- |
| InChIKey | RXDWDGTWQPDJKL-NTXQSYQBSA-N |
| XLogP | 13.01 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.95 |
| LogP ≤ 5 | 13.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|