C35H32 — CID 144938511
2-[(1Z)-buta-1,3-dienyl]-1-(4-ethylphenyl)-3-methyl-1-(4-methylphenyl)-6-phenylindene (PubChem CID 144938511) has the molecular formula C35H32 and a molecular weight of 452.64 g/mol. Its IUPAC name is 2-[(1Z)-buta-1,3-dienyl]-1-(4-ethylphenyl)-3-methyl-1-(4-methylphenyl)-6-phenylindene.
| Compound Name | 2-[(1Z)-buta-1,3-dienyl]-1-(4-ethylphenyl)-3-methyl-1-(4-methylphenyl)-6-phenylindene |
|---|---|
| PubChem CID | 144938511 |
| Molecular Formula | C35H32 |
| Molecular Weight | 452.64 g/mol |
| Exact Mass | 452.25 |
| IUPAC Name | 2-[(1Z)-buta-1,3-dienyl]-1-(4-ethylphenyl)-3-methyl-1-(4-methylphenyl)-6-phenylindene |
| SMILES | C=C/C=C\C1=C(C)c2ccc(-c3ccccc3)cc2C1(c1ccc(C)cc1)c1ccc(CC)cc1 |
| InChI | InChI=1S/C35H32/c1-5-7-13-33-26(4)32-23-18-29(28-11-9-8-10-12-28)24-34(32)35(33,30-19-14-25(3)15-20-30)31-21-16-27(6-2)17-22-31/h5,7-24H,1,6H2,2-4H3/b13-7- |
| InChIKey | HTYPVAVKYSAZTC-QPEQYQDCSA-N |
| XLogP | 9.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.64 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|