C26H22S — CID 170227138
2-[(1Z)-buta-1,3-dienyl]-1-methyl-3,3-diphenylindene-5-thiol (PubChem CID 170227138) has the molecular formula C26H22S and a molecular weight of 366.53 g/mol. Its IUPAC name is 2-[(1Z)-buta-1,3-dienyl]-1-methyl-3,3-diphenylindene-5-thiol.
| Compound Name | 2-[(1Z)-buta-1,3-dienyl]-1-methyl-3,3-diphenylindene-5-thiol |
|---|---|
| PubChem CID | 170227138 |
| Molecular Formula | C26H22S |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 2-[(1Z)-buta-1,3-dienyl]-1-methyl-3,3-diphenylindene-5-thiol |
| SMILES | C=C/C=C\C1=C(C)c2ccc(S)cc2C1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H22S/c1-3-4-15-24-19(2)23-17-16-22(27)18-25(23)26(24,20-11-7-5-8-12-20)21-13-9-6-10-14-21/h3-18,27H,1H2,2H3/b15-4- |
| InChIKey | UIABRSYDPJUVDA-TVPGTPATSA-N |
| XLogP | 6.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|