C26H20Br2 — CID 156509289
5-bromo-2-[(1Z)-3-bromobuta-1,3-dienyl]-3-methyl-1,1-diphenylindene (PubChem CID 156509289) has the molecular formula C26H20Br2 and a molecular weight of 492.25 g/mol. Its IUPAC name is 5-bromo-2-[(1Z)-3-bromobuta-1,3-dienyl]-3-methyl-1,1-diphenylindene.
| Compound Name | 5-bromo-2-[(1Z)-3-bromobuta-1,3-dienyl]-3-methyl-1,1-diphenylindene |
|---|---|
| PubChem CID | 156509289 |
| Molecular Formula | C26H20Br2 |
| Molecular Weight | 492.25 g/mol |
| Exact Mass | 489.99 |
| IUPAC Name | 5-bromo-2-[(1Z)-3-bromobuta-1,3-dienyl]-3-methyl-1,1-diphenylindene |
| SMILES | C=C(Br)/C=C\C1=C(C)c2cc(Br)ccc2C1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H20Br2/c1-18(27)13-15-24-19(2)23-17-22(28)14-16-25(23)26(24,20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3-17H,1H2,2H3/b15-13- |
| InChIKey | YDIQKAPTIROERI-SQFISAMPSA-N |
| XLogP | 8.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.25 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|