C29H16Br2N2 — CID 147587390
2-(2,6-dibromo-10,10-diphenylanthracen-9-ylidene)propanedinitrile (PubChem CID 147587390) has the molecular formula C29H16Br2N2 and a molecular weight of 552.27 g/mol. Its IUPAC name is 2-(2,6-dibromo-10,10-diphenylanthracen-9-ylidene)propanedinitrile.
| Compound Name | 2-(2,6-dibromo-10,10-diphenylanthracen-9-ylidene)propanedinitrile |
|---|---|
| PubChem CID | 147587390 |
| Molecular Formula | C29H16Br2N2 |
| Molecular Weight | 552.27 g/mol |
| Exact Mass | 549.97 |
| IUPAC Name | 2-(2,6-dibromo-10,10-diphenylanthracen-9-ylidene)propanedinitrile |
| SMILES | N#CC(C#N)=C1c2cc(Br)ccc2C(c2ccccc2)(c2ccccc2)c2cc(Br)ccc21 |
| InChI | InChI=1S/C29H16Br2N2/c30-22-12-14-26-25(15-22)28(19(17-32)18-33)24-13-11-23(31)16-27(24)29(26,20-7-3-1-4-8-20)21-9-5-2-6-10-21/h1-16H |
| InChIKey | FXPPOBKHVSHDDE-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.27 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'styrene_B(8)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|