C39H27N5 — CID 138484545
2-[2-[(Z)-but-1-en-3-ynyl]-1-methyl-3,3-diphenylinden-5-yl]-4,6-dipyridin-2-yl-1,3,5-triazine (PubChem CID 138484545) has the molecular formula C39H27N5 and a molecular weight of 565.68 g/mol. Its IUPAC name is 2-[2-[(Z)-but-1-en-3-ynyl]-1-methyl-3,3-diphenylinden-5-yl]-4,6-dipyridin-2-yl-1,3,5-triazine.
| Compound Name | 2-[2-[(Z)-but-1-en-3-ynyl]-1-methyl-3,3-diphenylinden-5-yl]-4,6-dipyridin-2-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 138484545 |
| Molecular Formula | C39H27N5 |
| Molecular Weight | 565.68 g/mol |
| Exact Mass | 565.23 |
| IUPAC Name | 2-[2-[(Z)-but-1-en-3-ynyl]-1-methyl-3,3-diphenylinden-5-yl]-4,6-dipyridin-2-yl-1,3,5-triazine |
| SMILES | C#C/C=C\C1=C(C)c2ccc(-c3nc(-c4ccccn4)nc(-c4ccccn4)n3)cc2C1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C39H27N5/c1-3-4-19-32-27(2)31-23-22-28(26-33(31)39(32,29-15-7-5-8-16-29)30-17-9-6-10-18-30)36-42-37(34-20-11-13-24-40-34)44-38(43-36)35-21-12-14-25-41-35/h1,4-26H,2H3/b19-4- |
| InChIKey | CKFPBJXGIYIDPL-PVOVUMCXSA-N |
| XLogP | 7.97 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.68 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|