C56H39N9 — CID 91340071
2-[2'-(4,6-dipyridin-2-yl-1,3,5-triazin-2-yl)-7,7'-dimethyl-9,9'-spirobi[fluorene]-2-yl]-4-(2-ethylphenyl)-6-pyridin-2-yl-1,3,5-triazine (PubChem CID 91340071) has the molecular formula C56H39N9 and a molecular weight of 837.99 g/mol. Its IUPAC name is 2-[2'-(4,6-dipyridin-2-yl-1,3,5-triazin-2-yl)-7,7'-dimethyl-9,9'-spirobi[fluorene]-2-yl]-4-(2-ethylphenyl)-6-pyridin-2-yl-1,3,5-triazine.
| Compound Name | 2-[2'-(4,6-dipyridin-2-yl-1,3,5-triazin-2-yl)-7,7'-dimethyl-9,9'-spirobi[fluorene]-2-yl]-4-(2-ethylphenyl)-6-pyridin-2-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 91340071 |
| Molecular Formula | C56H39N9 |
| Molecular Weight | 837.99 g/mol |
| Exact Mass | 837.33 |
| IUPAC Name | 2-[2'-(4,6-dipyridin-2-yl-1,3,5-triazin-2-yl)-7,7'-dimethyl-9,9'-spirobi[fluorene]-2-yl]-4-(2-ethylphenyl)-6-pyridin-2-yl-1,3,5-triazine |
| SMILES | CCc1ccccc1-c1nc(-c2ccc3c(c2)C2(c4cc(C)ccc4-c4ccc(-c5nc(-c6ccccn6)nc(-c6ccccn6)n5)cc42)c2cc(C)ccc2-3)nc(-c2ccccn2)n1 |
| InChI | InChI=1S/C56H39N9/c1-4-35-13-5-6-14-38(35)52-60-50(61-53(64-52)47-15-7-10-26-57-47)36-20-24-41-39-22-18-33(2)29-43(39)56(45(41)31-36)44-30-34(3)19-23-40(44)42-25-21-37(32-46(42)56)51-62-54(48-16-8-11-27-58-48)65-55(63-51)49-17-9-12-28-59-49/h5-32H,4H2,1-3H3 |
| InChIKey | JFVDGHZYOHJZLS-UHFFFAOYSA-N |
| XLogP | 11.77 |
| TPSA | 116.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.99 |
| LogP ≤ 5 | 11.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |