C62H47N — CID 142515593
9-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-9-phenyl-N,N,3-tris(4-phenylphenyl)fluoren-2-amine (PubChem CID 142515593) has the molecular formula C62H47N and a molecular weight of 806.07 g/mol. Its IUPAC name is 9-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-9-phenyl-N,N,3-tris(4-phenylphenyl)fluoren-2-amine.
| Compound Name | 9-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-9-phenyl-N,N,3-tris(4-phenylphenyl)fluoren-2-amine |
|---|---|
| PubChem CID | 142515593 |
| Molecular Formula | C62H47N |
| Molecular Weight | 806.07 g/mol |
| Exact Mass | 805.37 |
| IUPAC Name | 9-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-9-phenyl-N,N,3-tris(4-phenylphenyl)fluoren-2-amine |
| SMILES | C=C/C=C(\C=C/C)C1(c2ccccc2)c2ccccc2-c2cc(-c3ccc(-c4ccccc4)cc3)c(N(c3ccc(-c4ccccc4)cc3)c3ccc(-c4ccccc4)cc3)cc21 |
| InChI | InChI=1S/C62H47N/c1-3-19-52(20-4-2)62(53-27-15-8-16-28-53)59-30-18-17-29-56(59)58-43-57(51-33-31-48(32-34-51)45-21-9-5-10-22-45)61(44-60(58)62)63(54-39-35-49(36-40-54)46-23-11-6-12-24-46)55-41-37-50(38-42-55)47-25-13-7-14-26-47/h3-44H,1H2,2H3/b20-4-,52-19+ |
| InChIKey | RNUGYJLLGJNIEG-GMNVUJECSA-N |
| XLogP | 16.83 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.07 |
| LogP ≤ 5 | 16.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|