C63H52N2 — CID 145110271
9-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-N-[4-[(2E)-2-pent-4-enylidene-1,5-diphenyl-3H-indol-7-yl]phenyl]-N,9-diphenylfluoren-2-amine (PubChem CID 145110271) has the molecular formula C63H52N2 and a molecular weight of 837.12 g/mol. Its IUPAC name is 9-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-N-[4-[(2E)-2-pent-4-enylidene-1,5-diphenyl-3H-indol-7-yl]phenyl]-N,9-diphenylfluoren-2-amine.
| Compound Name | 9-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-N-[4-[(2E)-2-pent-4-enylidene-1,5-diphenyl-3H-indol-7-yl]phenyl]-N,9-diphenylfluoren-2-amine |
|---|---|
| PubChem CID | 145110271 |
| Molecular Formula | C63H52N2 |
| Molecular Weight | 837.12 g/mol |
| Exact Mass | 836.41 |
| IUPAC Name | 9-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-N-[4-[(2E)-2-pent-4-enylidene-1,5-diphenyl-3H-indol-7-yl]phenyl]-N,9-diphenylfluoren-2-amine |
| SMILES | C=C/C=C\C(=C/C)C1(c2ccccc2)c2ccccc2-c2ccc(N(c3ccccc3)c3ccc(-c4cc(-c5ccccc5)cc5c4N(c4ccccc4)/C(=C/CCC=C)C5)cc3)cc21 |
| InChI | InChI=1S/C63H52N2/c1-4-7-13-33-55-43-49-42-48(46-24-14-9-15-25-46)44-59(62(49)65(55)53-31-20-12-21-32-53)47-36-38-54(39-37-47)64(52-29-18-11-19-30-52)56-40-41-58-57-34-22-23-35-60(57)63(61(58)45-56,50(6-3)26-8-5-2)51-27-16-10-17-28-51/h4-6,8-12,14-42,44-45H,1-2,7,13,43H2,3H3/b26-8-,50-6+,55-33+ |
| InChIKey | WJRSLPJWEZAUIB-ISVLCGAUSA-N |
| XLogP | 17.04 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.12 |
| LogP ≤ 5 | 17.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|