C24H24O — CID 138623375
1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-3,3-dimethyl-1-phenylinden-2-one (PubChem CID 138623375) has the molecular formula C24H24O and a molecular weight of 328.46 g/mol. Its IUPAC name is 1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-3,3-dimethyl-1-phenylinden-2-one.
| Compound Name | 1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-3,3-dimethyl-1-phenylinden-2-one |
|---|---|
| PubChem CID | 138623375 |
| Molecular Formula | C24H24O |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-3,3-dimethyl-1-phenylinden-2-one |
| SMILES | C=C/C=C\C(=C/C)C1(c2ccccc2)C(=O)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C24H24O/c1-5-7-13-18(6-2)24(19-14-9-8-10-15-19)21-17-12-11-16-20(21)23(3,4)22(24)25/h5-17H,1H2,2-4H3/b13-7-,18-6+ |
| InChIKey | LXBIQJRNSCHWOI-CWNWGQNUSA-N |
| XLogP | 5.52 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|