C40H38 — CID 145302952
(10Z,12E)-1-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-8-[(2E,4Z)-hexa-2,4-dien-3-yl]-9-methylidene-8-phenyltetracyclo[11.6.1.02,7.014,19]icosa-2,4,6,10,12,14,16,18-octaene (PubChem CID 145302952) has the molecular formula C40H38 and a molecular weight of 518.74 g/mol. Its IUPAC name is (10Z,12E)-1-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-8-[(2E,4Z)-hexa-2,4-dien-3-yl]-9-methylidene-8-phenyltetracyclo[11.6.1.02,7.014,19]icosa-2,4,6,10,12,14,16,18-octaene.
| Compound Name | (10Z,12E)-1-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-8-[(2E,4Z)-hexa-2,4-dien-3-yl]-9-methylidene-8-phenyltetracyclo[11.6.1.02,7.014,19]icosa-2,4,6,10,12,14,16,18-octaene |
|---|---|
| PubChem CID | 145302952 |
| Molecular Formula | C40H38 |
| Molecular Weight | 518.74 g/mol |
| Exact Mass | 518.30 |
| IUPAC Name | (10Z,12E)-1-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-8-[(2E,4Z)-hexa-2,4-dien-3-yl]-9-methylidene-8-phenyltetracyclo[11.6.1.02,7.014,19]icosa-2,4,6,10,12,14,16,18-octaene |
| SMILES | C=C/C(=C\C=C/C)C12C/C(=C\C=C/C(=C)C(C(/C=C\C)=C/C)(c3ccccc3)c3ccccc31)c1ccccc12 |
| InChI | InChI=1S/C40H38/c1-6-10-22-32(8-3)39-29-31(35-25-14-15-26-36(35)39)21-18-20-30(5)40(33(9-4)19-7-2,34-23-12-11-13-24-34)38-28-17-16-27-37(38)39/h6-28H,3,5,29H2,1-2,4H3/b10-6-,19-7-,20-18-,31-21+,32-22+,33-9+ |
| InChIKey | GOFAICJQDUVCMK-DHFQUCOLSA-N |
| XLogP | 10.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.74 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|