C19H22 — CID 167499533
2-ethenyl-2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-5-methyl-1,3-dihydroindene (PubChem CID 167499533) has the molecular formula C19H22 and a molecular weight of 250.38 g/mol. Its IUPAC name is 2-ethenyl-2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-5-methyl-1,3-dihydroindene.
| Compound Name | 2-ethenyl-2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-5-methyl-1,3-dihydroindene |
|---|---|
| PubChem CID | 167499533 |
| Molecular Formula | C19H22 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 2-ethenyl-2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-5-methyl-1,3-dihydroindene |
| SMILES | C=C/C(=C\C=C/C)C1(C=C)Cc2ccc(C)cc2C1 |
| InChI | InChI=1S/C19H22/c1-5-8-9-18(6-2)19(7-3)13-16-11-10-15(4)12-17(16)14-19/h5-12H,2-3,13-14H2,1,4H3/b8-5-,18-9+ |
| InChIKey | OLCQREGIRDQWHV-YSWHLYNJSA-N |
| XLogP | 4.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|