C13H14O2 — CID 142202591
4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-4-hydroxycyclohexa-2,5-dien-1-one (PubChem CID 142202591) has the molecular formula C13H14O2 and a molecular weight of 202.25 g/mol. Its IUPAC name is 4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-4-hydroxycyclohexa-2,5-dien-1-one.
| Compound Name | 4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-4-hydroxycyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 142202591 |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-4-hydroxycyclohexa-2,5-dien-1-one |
| SMILES | C=C/C(=C\C=C/C)C1(O)C=CC(=O)C=C1 |
| InChI | InChI=1S/C13H14O2/c1-3-5-6-11(4-2)13(15)9-7-12(14)8-10-13/h3-10,15H,2H2,1H3/b5-3-,11-6+ |
| InChIKey | DCSHMVSOZOLKDA-GGKXIICKSA-N |
| XLogP | 2.10 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|