C14H14N2O — CID 130410788
4-[[[(3E,5Z)-hepta-1,3,5-trien-3-yl]diazenyl]methylidene]cyclohexa-2,5-dien-1-one (PubChem CID 130410788) has the molecular formula C14H14N2O and a molecular weight of 226.28 g/mol. Its IUPAC name is 4-[[[(3E,5Z)-hepta-1,3,5-trien-3-yl]diazenyl]methylidene]cyclohexa-2,5-dien-1-one.
| Compound Name | 4-[[[(3E,5Z)-hepta-1,3,5-trien-3-yl]diazenyl]methylidene]cyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 130410788 |
| Molecular Formula | C14H14N2O |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 4-[[[(3E,5Z)-hepta-1,3,5-trien-3-yl]diazenyl]methylidene]cyclohexa-2,5-dien-1-one |
| SMILES | C=CC(=C\C=C/C)/N=N\C=C1C=CC(=O)C=C1 |
| InChI | InChI=1S/C14H14N2O/c1-3-5-6-13(4-2)16-15-11-12-7-9-14(17)10-8-12/h3-11H,2H2,1H3/b5-3-,13-6+,16-15+ |
| InChIKey | HABLSNGAEOVEEF-HLWOQTIHSA-N |
| XLogP | 3.66 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|