C13H14N2S2 — CID 142052277
5-[[(3E,5Z)-hepta-1,3,5-trien-3-yl]diazenyl]benzene-1,3-dithiol (PubChem CID 142052277) has the molecular formula C13H14N2S2 and a molecular weight of 262.40 g/mol. Its IUPAC name is 5-[[(3E,5Z)-hepta-1,3,5-trien-3-yl]diazenyl]benzene-1,3-dithiol.
| Compound Name | 5-[[(3E,5Z)-hepta-1,3,5-trien-3-yl]diazenyl]benzene-1,3-dithiol |
|---|---|
| PubChem CID | 142052277 |
| Molecular Formula | C13H14N2S2 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 5-[[(3E,5Z)-hepta-1,3,5-trien-3-yl]diazenyl]benzene-1,3-dithiol |
| SMILES | C=CC(=C\C=C/C)/N=N/c1cc(S)cc(S)c1 |
| InChI | InChI=1S/C13H14N2S2/c1-3-5-6-10(4-2)14-15-11-7-12(16)9-13(17)8-11/h3-9,16-17H,2H2,1H3/b5-3-,10-6+,15-14+ |
| InChIKey | NUZVKTCJNLAYQG-INEXMFFJSA-N |
| XLogP | 4.99 |
| TPSA | 24.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|