C19H20N4 — CID 138655346
[(3E,5Z)-hepta-1,3,5-trien-4-yl]-[4-[[(3Z)-hexa-1,3,5-trien-2-yl]diazenyl]phenyl]diazene (PubChem CID 138655346) has the molecular formula C19H20N4 and a molecular weight of 304.40 g/mol. Its IUPAC name is [(3E,5Z)-hepta-1,3,5-trien-4-yl]-[4-[[(3Z)-hexa-1,3,5-trien-2-yl]diazenyl]phenyl]diazene.
| Compound Name | [(3E,5Z)-hepta-1,3,5-trien-4-yl]-[4-[[(3Z)-hexa-1,3,5-trien-2-yl]diazenyl]phenyl]diazene |
|---|---|
| PubChem CID | 138655346 |
| Molecular Formula | C19H20N4 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | [(3E,5Z)-hepta-1,3,5-trien-4-yl]-[4-[[(3Z)-hexa-1,3,5-trien-2-yl]diazenyl]phenyl]diazene |
| SMILES | C=C/C=C\C(=C)/N=N/c1ccc(/N=N/C(/C=C\C)=C/C=C)cc1 |
| InChI | InChI=1S/C19H20N4/c1-5-8-11-16(4)20-21-18-12-14-19(15-13-18)23-22-17(9-6-2)10-7-3/h5-15H,1-2,4H2,3H3/b10-7-,11-8-,17-9+,21-20+,23-22+ |
| InChIKey | PNDNIFZQUDYRBA-LEPLTXIRSA-N |
| XLogP | 6.76 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|