C21H22N6S2 — CID 166900263
N,N-dimethyl-4-[[(3E,5Z)-7-[(5-methylthieno[2,3-d][1,3]thiazol-2-yl)diazenyl]hepta-1,3,5-trien-4-yl]diazenyl]aniline (PubChem CID 166900263) has the molecular formula C21H22N6S2 and a molecular weight of 422.58 g/mol. Its IUPAC name is N,N-dimethyl-4-[[(3E,5Z)-7-[(5-methylthieno[2,3-d][1,3]thiazol-2-yl)diazenyl]hepta-1,3,5-trien-4-yl]diazenyl]aniline.
| Compound Name | N,N-dimethyl-4-[[(3E,5Z)-7-[(5-methylthieno[2,3-d][1,3]thiazol-2-yl)diazenyl]hepta-1,3,5-trien-4-yl]diazenyl]aniline |
|---|---|
| PubChem CID | 166900263 |
| Molecular Formula | C21H22N6S2 |
| Molecular Weight | 422.58 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | N,N-dimethyl-4-[[(3E,5Z)-7-[(5-methylthieno[2,3-d][1,3]thiazol-2-yl)diazenyl]hepta-1,3,5-trien-4-yl]diazenyl]aniline |
| SMILES | C=C/C=C(\C=C/C/N=N/c1nc2sc(C)cc2s1)/N=N/c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C21H22N6S2/c1-5-7-16(24-25-17-9-11-18(12-10-17)27(3)4)8-6-13-22-26-21-23-20-19(29-21)14-15(2)28-20/h5-12,14H,1,13H2,2-4H3/b8-6-,16-7+,25-24+,26-22+ |
| InChIKey | PDLUBEHWQULYMF-TVVVJDGNSA-N |
| XLogP | 7.23 |
| TPSA | 65.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.58 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|