C14H14N2 — CID 126603537
[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-phenyldiazene (PubChem CID 126603537) has the molecular formula C14H14N2 and a molecular weight of 210.28 g/mol. Its IUPAC name is [(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-phenyldiazene.
| Compound Name | [(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-phenyldiazene |
|---|---|
| PubChem CID | 126603537 |
| Molecular Formula | C14H14N2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | [(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-phenyldiazene |
| SMILES | C=C/C=C\C(=C/C=C)\N=N\c1ccccc1 |
| InChI | InChI=1S/C14H14N2/c1-3-5-10-13(9-4-2)15-16-14-11-7-6-8-12-14/h3-12H,1-2H2/b10-5-,13-9+,16-15+ |
| InChIKey | BIGCVHVZUQOLSJ-YVOLVREMSA-N |
| XLogP | 4.58 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|