C27H33NP2 — CID 130280362
[[(3E,5Z)-hepta-1,3,5-trien-4-yl]-[[[(2E,4Z)-hepta-2,4,6-trien-3-yl]-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phosphanyl]amino]phosphanyl]benzene (PubChem CID 130280362) has the molecular formula C27H33NP2 and a molecular weight of 433.52 g/mol. Its IUPAC name is [[(3E,5Z)-hepta-1,3,5-trien-4-yl]-[[[(2E,4Z)-hepta-2,4,6-trien-3-yl]-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phosphanyl]amino]phosphanyl]benzene.
| Compound Name | [[(3E,5Z)-hepta-1,3,5-trien-4-yl]-[[[(2E,4Z)-hepta-2,4,6-trien-3-yl]-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phosphanyl]amino]phosphanyl]benzene |
|---|---|
| PubChem CID | 130280362 |
| Molecular Formula | C27H33NP2 |
| Molecular Weight | 433.52 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | [[(3E,5Z)-hepta-1,3,5-trien-4-yl]-[[[(2E,4Z)-hepta-2,4,6-trien-3-yl]-[(3E,5Z)-hepta-1,3,5-trien-4-yl]phosphanyl]amino]phosphanyl]benzene |
| SMILES | C=C/C=C\C(=C/C)P(NP(C(/C=C\C)=C/C=C)c1ccccc1)C(/C=C\C)=C/C=C |
| InChI | InChI=1S/C27H33NP2/c1-7-13-21-24(12-6)29(25(17-8-2)18-9-3)28-30(26(19-10-4)20-11-5)27-22-15-14-16-23-27/h7-23,28H,1-2,4H2,3,5-6H3/b18-9-,20-11-,21-13-,24-12+,25-17+,26-19+ |
| InChIKey | MKNHETUZAQQFBE-XKVCFQSNSA-N |
| XLogP | 8.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.52 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|