C16H20ClP — CID 155373823
chloro-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-[(3Z,5E)-nona-1,3,5,8-tetraen-5-yl]phosphane (PubChem CID 155373823) has the molecular formula C16H20ClP and a molecular weight of 278.76 g/mol. Its IUPAC name is chloro-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-[(3Z,5E)-nona-1,3,5,8-tetraen-5-yl]phosphane.
| Compound Name | chloro-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-[(3Z,5E)-nona-1,3,5,8-tetraen-5-yl]phosphane |
|---|---|
| PubChem CID | 155373823 |
| Molecular Formula | C16H20ClP |
| Molecular Weight | 278.76 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | chloro-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-[(3Z,5E)-nona-1,3,5,8-tetraen-5-yl]phosphane |
| SMILES | C=C/C=C\C(=C/CC=C)P(Cl)C(/C=C\C)=C/C=C |
| InChI | InChI=1S/C16H20ClP/c1-5-9-13-16(14-10-6-2)18(17)15(11-7-3)12-8-4/h5-9,11-14H,1-3,10H2,4H3/b12-8-,13-9-,15-11+,16-14+ |
| InChIKey | BXCUESWGSMWVMC-QZMWQVLNSA-N |
| XLogP | 6.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.76 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|