C24H42O — CID 143334709
ethane;(3Z,5E)-5-[(2E,4Z)-hexa-2,4-dien-3-yl]oxynona-1,3,5,8-tetraene;(Z)-pent-2-ene (PubChem CID 143334709) has the molecular formula C24H42O and a molecular weight of 346.60 g/mol. Its IUPAC name is ethane;(3Z,5E)-5-[(2E,4Z)-hexa-2,4-dien-3-yl]oxynona-1,3,5,8-tetraene;(Z)-pent-2-ene.
| Compound Name | ethane;(3Z,5E)-5-[(2E,4Z)-hexa-2,4-dien-3-yl]oxynona-1,3,5,8-tetraene;(Z)-pent-2-ene |
|---|---|
| PubChem CID | 143334709 |
| Molecular Formula | C24H42O |
| Molecular Weight | 346.60 g/mol |
| Exact Mass | 346.32 |
| IUPAC Name | ethane;(3Z,5E)-5-[(2E,4Z)-hexa-2,4-dien-3-yl]oxynona-1,3,5,8-tetraene;(Z)-pent-2-ene |
| SMILES | C/C=C\CC.C=C/C=C\C(=C/CC=C)OC(/C=C\C)=C/C.CC.CC |
| InChI | InChI=1S/C15H20O.C5H10.2C2H6/c1-5-9-12-15(13-10-6-2)16-14(8-4)11-7-3;1-3-5-4-2;2*1-2/h5-9,11-13H,1-2,10H2,3-4H3;3,5H,4H2,1-2H3;2*1-2H3/b11-7-,12-9-,14-8+,15-13+;5-3-;; |
| InChIKey | UDOHLJAOLCNINE-FCPQKSEVSA-N |
| XLogP | 8.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.60 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|