C14H19O2P — CID 134424390
[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxy-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxyphosphane (PubChem CID 134424390) has the molecular formula C14H19O2P and a molecular weight of 250.28 g/mol. Its IUPAC name is [(2E,4Z)-hepta-2,4,6-trien-3-yl]oxy-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxyphosphane.
| Compound Name | [(2E,4Z)-hepta-2,4,6-trien-3-yl]oxy-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxyphosphane |
|---|---|
| PubChem CID | 134424390 |
| Molecular Formula | C14H19O2P |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | [(2E,4Z)-hepta-2,4,6-trien-3-yl]oxy-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxyphosphane |
| SMILES | C=C/C=C\C(=C/C)OPOC(/C=C\C)=C/C=C |
| InChI | InChI=1S/C14H19O2P/c1-5-9-12-13(8-4)15-17-16-14(10-6-2)11-7-3/h5-12,17H,1-2H2,3-4H3/b11-7-,12-9-,13-8+,14-10+ |
| InChIKey | KAZPXCQTFSFINX-DILUHCKKSA-N |
| XLogP | 4.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|