C19H33BO2 — CID 142048530
ethane;[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxy-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxy-methylborane (PubChem CID 142048530) has the molecular formula C19H33BO2 and a molecular weight of 304.28 g/mol. Its IUPAC name is ethane;[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxy-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxy-methylborane.
| Compound Name | ethane;[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxy-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxy-methylborane |
|---|---|
| PubChem CID | 142048530 |
| Molecular Formula | C19H33BO2 |
| Molecular Weight | 304.28 g/mol |
| Exact Mass | 304.26 |
| IUPAC Name | ethane;[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxy-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxy-methylborane |
| SMILES | C=C/C=C(\C=C/C)OB(C)O/C(C=C)=C/C=C\C.CC.CC |
| InChI | InChI=1S/C15H21BO2.2C2H6/c1-6-10-13-14(9-4)17-16(5)18-15(11-7-2)12-8-3;2*1-2/h6-13H,2,4H2,1,3,5H3;2*1-2H3/b10-6-,12-8-,14-13+,15-11+;; |
| InChIKey | TZWDOCZLZBTODM-ULGDJYQDSA-N |
| XLogP | 6.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.28 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|