C10H12O2 — CID 118422055
[(3E,5Z)-hepta-1,3,5-trien-4-yl] prop-2-enoate (PubChem CID 118422055) has the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is [(3E,5Z)-hepta-1,3,5-trien-4-yl] prop-2-enoate.
| Compound Name | [(3E,5Z)-hepta-1,3,5-trien-4-yl] prop-2-enoate |
|---|---|
| PubChem CID | 118422055 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | [(3E,5Z)-hepta-1,3,5-trien-4-yl] prop-2-enoate |
| SMILES | C=C/C=C(\C=C/C)OC(=O)C=C |
| InChI | InChI=1S/C10H12O2/c1-4-7-9(8-5-2)12-10(11)6-3/h4-8H,1,3H2,2H3/b8-5-,9-7+ |
| InChIKey | HMDUNPFIQOLCRL-ANVCMGODSA-N |
| XLogP | 2.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|