C16H20O3 — CID 146390791
[(2E,4Z)-hepta-2,4,6-trien-3-yl] [(2Z,4E,6Z)-octa-2,4,6-trien-4-yl] carbonate (PubChem CID 146390791) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is [(2E,4Z)-hepta-2,4,6-trien-3-yl] [(2Z,4E,6Z)-octa-2,4,6-trien-4-yl] carbonate.
| Compound Name | [(2E,4Z)-hepta-2,4,6-trien-3-yl] [(2Z,4E,6Z)-octa-2,4,6-trien-4-yl] carbonate |
|---|---|
| PubChem CID | 146390791 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | [(2E,4Z)-hepta-2,4,6-trien-3-yl] [(2Z,4E,6Z)-octa-2,4,6-trien-4-yl] carbonate |
| SMILES | C=C/C=C\C(=C/C)OC(=O)OC(/C=C\C)=C/C=C\C |
| InChI | InChI=1S/C16H20O3/c1-5-9-12-14(8-4)18-16(17)19-15(11-7-3)13-10-6-2/h5-13H,1H2,2-4H3/b10-6-,11-7-,12-9-,14-8+,15-13+ |
| InChIKey | XHLSUIVJBABOQA-DDKJSDOWSA-N |
| XLogP | 4.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|