C14H20 — CID 177369316
(3Z,5E,6E,8Z)-6-ethyl-5-ethylidenedeca-1,3,6,8-tetraene (PubChem CID 177369316) has the molecular formula C14H20 and a molecular weight of 188.31 g/mol. Its IUPAC name is (3Z,5E,6E,8Z)-6-ethyl-5-ethylidenedeca-1,3,6,8-tetraene.
| Compound Name | (3Z,5E,6E,8Z)-6-ethyl-5-ethylidenedeca-1,3,6,8-tetraene |
|---|---|
| PubChem CID | 177369316 |
| Molecular Formula | C14H20 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | (3Z,5E,6E,8Z)-6-ethyl-5-ethylidenedeca-1,3,6,8-tetraene |
| SMILES | C=C/C=C\C(=C/C)\C(=C\C=C/C)CC |
| InChI | InChI=1S/C14H20/c1-5-9-11-13(7-3)14(8-4)12-10-6-2/h5-7,9-12H,1,8H2,2-4H3/b10-6-,11-9-,13-7+,14-12+ |
| InChIKey | CNLVBRJNAZWARO-GUJLXGAUSA-N |
| XLogP | 4.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|