C20H24 — CID 142480935
[(1E,3E,5E,6Z)-5-ethylidene-4-propylnona-1,3,6,8-tetraenyl]benzene (PubChem CID 142480935) has the molecular formula C20H24 and a molecular weight of 264.41 g/mol. Its IUPAC name is [(1E,3E,5E,6Z)-5-ethylidene-4-propylnona-1,3,6,8-tetraenyl]benzene.
| Compound Name | [(1E,3E,5E,6Z)-5-ethylidene-4-propylnona-1,3,6,8-tetraenyl]benzene |
|---|---|
| PubChem CID | 142480935 |
| Molecular Formula | C20H24 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.19 |
| IUPAC Name | [(1E,3E,5E,6Z)-5-ethylidene-4-propylnona-1,3,6,8-tetraenyl]benzene |
| SMILES | C=C/C=C\C(=C/C)\C(=C\C=C\c1ccccc1)CCC |
| InChI | InChI=1S/C20H24/c1-4-7-16-19(6-3)20(12-5-2)17-11-15-18-13-9-8-10-14-18/h4,6-11,13-17H,1,5,12H2,2-3H3/b15-11+,16-7-,19-6+,20-17+ |
| InChIKey | PQTPONDNOMPAQX-SUWWJSBESA-N |
| XLogP | 6.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|