C20H22 — CID 145291753
[(1Z,3Z,5Z,7Z)-9-methyl-4-prop-1-en-2-yldeca-1,3,5,7,9-pentaenyl]benzene (PubChem CID 145291753) has the molecular formula C20H22 and a molecular weight of 262.40 g/mol. Its IUPAC name is [(1Z,3Z,5Z,7Z)-9-methyl-4-prop-1-en-2-yldeca-1,3,5,7,9-pentaenyl]benzene.
| Compound Name | [(1Z,3Z,5Z,7Z)-9-methyl-4-prop-1-en-2-yldeca-1,3,5,7,9-pentaenyl]benzene |
|---|---|
| PubChem CID | 145291753 |
| Molecular Formula | C20H22 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | [(1Z,3Z,5Z,7Z)-9-methyl-4-prop-1-en-2-yldeca-1,3,5,7,9-pentaenyl]benzene |
| SMILES | C=C(C)/C=C\C=C/C(=C/C=C\c1ccccc1)C(=C)C |
| InChI | InChI=1S/C20H22/c1-17(2)11-8-9-15-20(18(3)4)16-10-14-19-12-6-5-7-13-19/h5-16H,1,3H2,2,4H3/b11-8-,14-10-,15-9-,20-16- |
| InChIKey | NDORLMRSLHTHMG-CENNMZEWSA-N |
| XLogP | 5.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|