C21H38 — CID 142426246
ethane;(3Z,5Z)-2-methylhepta-1,3,5-triene;toluene (PubChem CID 142426246) has the molecular formula C21H38 and a molecular weight of 290.54 g/mol. Its IUPAC name is ethane;(3Z,5Z)-2-methylhepta-1,3,5-triene;toluene.
| Compound Name | ethane;(3Z,5Z)-2-methylhepta-1,3,5-triene;toluene |
|---|---|
| PubChem CID | 142426246 |
| Molecular Formula | C21H38 |
| Molecular Weight | 290.54 g/mol |
| Exact Mass | 290.30 |
| IUPAC Name | ethane;(3Z,5Z)-2-methylhepta-1,3,5-triene;toluene |
| SMILES | C=C(C)/C=C\C=C/C.CC.CC.CC.Cc1ccccc1 |
| InChI | InChI=1S/C8H12.C7H8.3C2H6/c1-4-5-6-7-8(2)3;1-7-5-3-2-4-6-7;3*1-2/h4-7H,2H2,1,3H3;2-6H,1H3;3*1-2H3/b5-4-,7-6-;;;; |
| InChIKey | WBKDLTSUQVMESW-JNYRBGHMSA-N |
| XLogP | 7.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.54 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|