C18H29F — CID 144678741
ethane;(3Z)-2-fluoro-5-methylhexa-1,3,5-triene;toluene (PubChem CID 144678741) has the molecular formula C18H29F and a molecular weight of 264.43 g/mol. Its IUPAC name is ethane;(3Z)-2-fluoro-5-methylhexa-1,3,5-triene;toluene.
| Compound Name | ethane;(3Z)-2-fluoro-5-methylhexa-1,3,5-triene;toluene |
|---|---|
| PubChem CID | 144678741 |
| Molecular Formula | C18H29F |
| Molecular Weight | 264.43 g/mol |
| Exact Mass | 264.23 |
| IUPAC Name | ethane;(3Z)-2-fluoro-5-methylhexa-1,3,5-triene;toluene |
| SMILES | C=C(C)/C=C\C(=C)F.CC.CC.Cc1ccccc1 |
| InChI | InChI=1S/C7H9F.C7H8.2C2H6/c1-6(2)4-5-7(3)8;1-7-5-3-2-4-6-7;2*1-2/h4-5H,1,3H2,2H3;2-6H,1H3;2*1-2H3/b5-4-;;; |
| InChIKey | YFJQVNTZVFQHEG-OAWHIZORSA-N |
| XLogP | 6.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.43 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|