About ethane;(3Z)-2-fluoro-5-methylhexa-1,3,5-triene;toluene
ethane;(3Z)-2-fluoro-5-methylhexa-1,3,5-triene;toluene (PubChem CID 144678741) has the molecular formula C18H29F
and a molecular weight of 264.43 g/mol. Its IUPAC name is ethane;(3Z)-2-fluoro-5-methylhexa-1,3,5-triene;toluene.
Molecular Properties
| Compound Name | ethane;(3Z)-2-fluoro-5-methylhexa-1,3,5-triene;toluene |
| PubChem CID | 144678741 |
| Molecular Formula | C18H29F |
| Molecular Weight | 264.43 g/mol |
| Exact Mass | 264.23 |
| IUPAC Name | ethane;(3Z)-2-fluoro-5-methylhexa-1,3,5-triene;toluene |
| SMILES | C=C(C)/C=C\C(=C)F.CC.CC.Cc1ccccc1 |
| InChI | InChI=1S/C7H9F.C7H8.2C2H6/c1-6(2)4-5-7(3)8;1-7-5-3-2-4-6-7;2*1-2/h4-5H,1,3H2,2H3;2-6H,1H3;2*1-2H3/b5-4-;;; |
| InChIKey | YFJQVNTZVFQHEG-OAWHIZORSA-N |
| XLogP | 6.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 264.43 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;(3Z)-2-fluoro-5-methylhexa-1,3,5-triene;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(3Z)-2-fluoro-5-methylhexa-1,3,5-triene;toluene?
The IUPAC name of ethane;(3Z)-2-fluoro-5-methylhexa-1,3,5-triene;toluene (CID 144678741) is ethane;(3Z)-2-fluoro-5-methylhexa-1,3,5-triene;toluene.
What is the SMILES notation for ethane;(3Z)-2-fluoro-5-methylhexa-1,3,5-triene;toluene?
The canonical SMILES for ethane;(3Z)-2-fluoro-5-methylhexa-1,3,5-triene;toluene is C=C(C)/C=C\C(=C)F.CC.CC.Cc1ccccc1.
What is the InChIKey of ethane;(3Z)-2-fluoro-5-methylhexa-1,3,5-triene;toluene?
The InChIKey is YFJQVNTZVFQHEG-OAWHIZORSA-N. The full InChI is InChI=1S/C7H9F.C7H8.2C2H6/c1-6(2)4-5-7(3)8;1-7-5-3-2-4-6-7;2*1-2/h4-5H,1,3H2,2H3;2-6H,1H3;2*1-2H3/b5-4-;;;.
What are the key properties of ethane;(3Z)-2-fluoro-5-methylhexa-1,3,5-triene;toluene?
ethane;(3Z)-2-fluoro-5-methylhexa-1,3,5-triene;toluene has a molecular weight of 264.43 g/mol, XLogP of 6.65, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(3Z)-2-fluoro-5-methylhexa-1,3,5-triene;toluene is sourced from PubChem (CID 144678741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).