C13H15F — CID 143485598
(3Z,7Z)-2-fluoro-9-methyl-5,6-dimethylidenedeca-1,3,7,9-tetraene (PubChem CID 143485598) has the molecular formula C13H15F and a molecular weight of 190.26 g/mol. Its IUPAC name is (3Z,7Z)-2-fluoro-9-methyl-5,6-dimethylidenedeca-1,3,7,9-tetraene.
| Compound Name | (3Z,7Z)-2-fluoro-9-methyl-5,6-dimethylidenedeca-1,3,7,9-tetraene |
|---|---|
| PubChem CID | 143485598 |
| Molecular Formula | C13H15F |
| Molecular Weight | 190.26 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | (3Z,7Z)-2-fluoro-9-methyl-5,6-dimethylidenedeca-1,3,7,9-tetraene |
| SMILES | C=C(C)/C=C\C(=C)C(=C)/C=C\C(=C)F |
| InChI | InChI=1S/C13H15F/c1-10(2)6-7-11(3)12(4)8-9-13(5)14/h6-9H,1,3-5H2,2H3/b7-6-,9-8- |
| InChIKey | UEWQLALEXYMXLG-JPDBVBESSA-N |
| XLogP | 4.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.26 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|