C12H15FO — CID 142308296
(4E,7Z)-9-fluoro-5-methyl-6-methylidenedeca-4,7,9-trien-2-one (PubChem CID 142308296) has the molecular formula C12H15FO and a molecular weight of 194.25 g/mol. Its IUPAC name is (4E,7Z)-9-fluoro-5-methyl-6-methylidenedeca-4,7,9-trien-2-one.
| Compound Name | (4E,7Z)-9-fluoro-5-methyl-6-methylidenedeca-4,7,9-trien-2-one |
|---|---|
| PubChem CID | 142308296 |
| Molecular Formula | C12H15FO |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | (4E,7Z)-9-fluoro-5-methyl-6-methylidenedeca-4,7,9-trien-2-one |
| SMILES | C=C(F)/C=C\C(=C)/C(C)=C/CC(C)=O |
| InChI | InChI=1S/C12H15FO/c1-9(5-7-11(3)13)10(2)6-8-12(4)14/h5-7H,1,3,8H2,2,4H3/b7-5-,10-6+ |
| InChIKey | LFWNETWDZKGGFC-ZPRNNRRZSA-N |
| XLogP | 3.51 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|