5-chloro-2-methylhexa-2,5-dienoic acid

C7H9ClO2 — CID 91398542

IUPAC5-chloro-2-methylhexa-2,5-dienoic acid
SMILESC=C(Cl)CC=C(C)C(=O)O
InChIInChI=1S/C7H9ClO2/c1-5(7(9)10)3-4-6(2)8/h3H,2,4H2,1H3,(H,9,10)
InChIKeyVHZUULVSAOEOBG-UHFFFAOYSA-N
MW160.60 g/mol
LogP2.16
Rot. Bonds3

About 5-chloro-2-methylhexa-2,5-dienoic acid

5-chloro-2-methylhexa-2,5-dienoic acid (PubChem CID 91398542) has the molecular formula C7H9ClO2 and a molecular weight of 160.60 g/mol. Its IUPAC name is 5-chloro-2-methylhexa-2,5-dienoic acid.

Molecular Properties

Compound Name5-chloro-2-methylhexa-2,5-dienoic acid
PubChem CID91398542
Molecular FormulaC7H9ClO2
Molecular Weight160.60 g/mol
Exact Mass160.03
IUPAC Name5-chloro-2-methylhexa-2,5-dienoic acid
SMILESC=C(Cl)CC=C(C)C(=O)O
InChIInChI=1S/C7H9ClO2/c1-5(7(9)10)3-4-6(2)8/h3H,2,4H2,1H3,(H,9,10)
InChIKeyVHZUULVSAOEOBG-UHFFFAOYSA-N
XLogP2.16
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500160.60
LogP ≤ 52.16
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 5-chloro-2-methylhexa-2,5-dienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-chloro-2-methylhexa-2,5-dienoic acid?
The IUPAC name of 5-chloro-2-methylhexa-2,5-dienoic acid (CID 91398542) is 5-chloro-2-methylhexa-2,5-dienoic acid.
What is the SMILES notation for 5-chloro-2-methylhexa-2,5-dienoic acid?
The canonical SMILES for 5-chloro-2-methylhexa-2,5-dienoic acid is C=C(Cl)CC=C(C)C(=O)O.
What is the InChIKey of 5-chloro-2-methylhexa-2,5-dienoic acid?
The InChIKey is VHZUULVSAOEOBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9ClO2/c1-5(7(9)10)3-4-6(2)8/h3H,2,4H2,1H3,(H,9,10).
What are the key properties of 5-chloro-2-methylhexa-2,5-dienoic acid?
5-chloro-2-methylhexa-2,5-dienoic acid has a molecular weight of 160.60 g/mol, XLogP of 2.16, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-methylhexa-2,5-dienoic acid is sourced from PubChem (CID 91398542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).